C28H30ClF2N5O5 — CID 138526457
methyl N-[(14S)-14-[(6R)-6-(3-chloro-2,6-difluorophenyl)-2-oxo-1,3-oxazinan-3-yl]-4-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,6,15-tetraen-5-yl]carbamate (PubChem CID 138526457) has the molecular formula C28H30ClF2N5O5 and a molecular weight of 590.03 g/mol. Its IUPAC name is methyl N-[(14S)-14-[(6R)-6-(3-chloro-2,6-difluorophenyl)-2-oxo-1,3-oxazinan-3-yl]-4-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,6,15-tetraen-5-yl]carbamate.
| Compound Name | methyl N-[(14S)-14-[(6R)-6-(3-chloro-2,6-difluorophenyl)-2-oxo-1,3-oxazinan-3-yl]-4-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,6,15-tetraen-5-yl]carbamate |
|---|---|
| PubChem CID | 138526457 |
| Molecular Formula | C28H30ClF2N5O5 |
| Molecular Weight | 590.03 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | methyl N-[(14S)-14-[(6R)-6-(3-chloro-2,6-difluorophenyl)-2-oxo-1,3-oxazinan-3-yl]-4-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,6,15-tetraen-5-yl]carbamate |
| SMILES | COC(=O)NC1C=C2NC(=O)CCCC[C@H](N3CC[C@H](c4c(F)ccc(Cl)c4F)OC3=O)c3ncc([nH]3)C2=CC1C |
| InChI | InChI=1S/C28H30ClF2N5O5/c1-14-11-15-19(12-18(14)35-27(38)40-2)33-23(37)6-4-3-5-21(26-32-13-20(15)34-26)36-10-9-22(41-28(36)39)24-17(30)8-7-16(29)25(24)31/h7-8,11-14,18,21-22H,3-6,9-10H2,1-2H3,(H,32,34)(H,33,37)(H,35,38)/t14?,18?,21-,22+/m0/s1 |
| InChIKey | GHIAXNHDGXZTCD-ULRUQMGYSA-N |
| XLogP | 5.30 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.03 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|