C10H17N3O4 — CID 62094367
2-[(2-oxopiperidin-3-yl)carbamoylamino]butanoic acid (PubChem CID 62094367) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-[(2-oxopiperidin-3-yl)carbamoylamino]butanoic acid.
| Compound Name | 2-[(2-oxopiperidin-3-yl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 62094367 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-[(2-oxopiperidin-3-yl)carbamoylamino]butanoic acid |
| SMILES | CCC(NC(=O)NC1CCCNC1=O)C(=O)O |
| InChI | InChI=1S/C10H17N3O4/c1-2-6(9(15)16)12-10(17)13-7-4-3-5-11-8(7)14/h6-7H,2-5H2,1H3,(H,11,14)(H,15,16)(H2,12,13,17) |
| InChIKey | QUNUXSSMYNQVEW-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |