C9H15BrN2O2 — CID 62856171
2-bromo-N-(2-oxopiperidin-3-yl)butanamide (PubChem CID 62856171) has the molecular formula C9H15BrN2O2 and a molecular weight of 263.13 g/mol. Its IUPAC name is 2-bromo-N-(2-oxopiperidin-3-yl)butanamide.
| Compound Name | 2-bromo-N-(2-oxopiperidin-3-yl)butanamide |
|---|---|
| PubChem CID | 62856171 |
| Molecular Formula | C9H15BrN2O2 |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 2-bromo-N-(2-oxopiperidin-3-yl)butanamide |
| SMILES | CCC(Br)C(=O)NC1CCCNC1=O |
| InChI | InChI=1S/C9H15BrN2O2/c1-2-6(10)8(13)12-7-4-3-5-11-9(7)14/h6-7H,2-5H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | PGILFDDGYRQZAM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|