C14H21NO — CID 166445808
3-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroinden-2-ylidene]piperidin-2-one (PubChem CID 166445808) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroinden-2-ylidene]piperidin-2-one.
| Compound Name | 3-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroinden-2-ylidene]piperidin-2-one |
|---|---|
| PubChem CID | 166445808 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 3-[(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydroinden-2-ylidene]piperidin-2-one |
| SMILES | O=C1NCCC/C1=C1/C[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C14H21NO/c16-14-13(6-3-7-15-14)12-8-10-4-1-2-5-11(10)9-12/h10-11H,1-9H2,(H,15,16)/b13-12-/t10-,11+/m0/s1 |
| InChIKey | RSZDHJUTAHLRKM-HDTCZIKISA-N |
| XLogP | 2.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|