C14H20O — CID 82254217
2,3,4,4a,5,6,7,8,10,10a-decahydro-1H-phenanthren-9-one (PubChem CID 82254217) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,8,10,10a-decahydro-1H-phenanthren-9-one.
| Compound Name | 2,3,4,4a,5,6,7,8,10,10a-decahydro-1H-phenanthren-9-one |
|---|---|
| PubChem CID | 82254217 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2,3,4,4a,5,6,7,8,10,10a-decahydro-1H-phenanthren-9-one |
| SMILES | O=C1CC2CCCCC2C2=C1CCCC2 |
| InChI | InChI=1S/C14H20O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h10-11H,1-9H2 |
| InChIKey | MZAXIHBJCZXCBU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |