C12H20O — CID 102063189
(3aR,10aS)-2,3,3a,5,6,7,8,9,10,10a-decahydro-1H-cyclopenta[9]annulen-4-one (PubChem CID 102063189) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3aR,10aS)-2,3,3a,5,6,7,8,9,10,10a-decahydro-1H-cyclopenta[9]annulen-4-one.
| Compound Name | (3aR,10aS)-2,3,3a,5,6,7,8,9,10,10a-decahydro-1H-cyclopenta[9]annulen-4-one |
|---|---|
| PubChem CID | 102063189 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3aR,10aS)-2,3,3a,5,6,7,8,9,10,10a-decahydro-1H-cyclopenta[9]annulen-4-one |
| SMILES | O=C1CCCCCC[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C12H20O/c13-12-9-4-2-1-3-6-10-7-5-8-11(10)12/h10-11H,1-9H2/t10-,11+/m0/s1 |
| InChIKey | NHDUSBRUDPYAFQ-WDEREUQCSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |