C10H14O — CID 12604194
4-methyl-2,3,4,5,6,7-hexahydroinden-1-one (PubChem CID 12604194) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 4-methyl-2,3,4,5,6,7-hexahydroinden-1-one.
| Compound Name | 4-methyl-2,3,4,5,6,7-hexahydroinden-1-one |
|---|---|
| PubChem CID | 12604194 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 4-methyl-2,3,4,5,6,7-hexahydroinden-1-one |
| SMILES | CC1CCCC2=C1CCC2=O |
| InChI | InChI=1S/C10H14O/c1-7-3-2-4-9-8(7)5-6-10(9)11/h7H,2-6H2,1H3 |
| InChIKey | YOHADDQDDUVYJE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |