C9H16N2O — CID 165457744
1,2,3,4,4a,5,6,7,8,9a-decahydropyrido[2,3-c]azepin-9-one (PubChem CID 165457744) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,9a-decahydropyrido[2,3-c]azepin-9-one.
| Compound Name | 1,2,3,4,4a,5,6,7,8,9a-decahydropyrido[2,3-c]azepin-9-one |
|---|---|
| PubChem CID | 165457744 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,9a-decahydropyrido[2,3-c]azepin-9-one |
| SMILES | O=C1NCCCC2CCCNC12 |
| InChI | InChI=1S/C9H16N2O/c12-9-8-7(3-1-5-10-8)4-2-6-11-9/h7-8,10H,1-6H2,(H,11,12) |
| InChIKey | FDDUZOHWQSGEQR-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |