C6H9NO2 — CID 101490827
(1R,7R)-8-oxa-3-azabicyclo[5.1.0]octan-2-one (PubChem CID 101490827) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is (1R,7R)-8-oxa-3-azabicyclo[5.1.0]octan-2-one.
| Compound Name | (1R,7R)-8-oxa-3-azabicyclo[5.1.0]octan-2-one |
|---|---|
| PubChem CID | 101490827 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (1R,7R)-8-oxa-3-azabicyclo[5.1.0]octan-2-one |
| SMILES | O=C1NCCC[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C6H9NO2/c8-6-5-4(9-5)2-1-3-7-6/h4-5H,1-3H2,(H,7,8)/t4-,5-/m1/s1 |
| InChIKey | SKOQIODTOXWRCJ-RFZPGFLSSA-N |
| XLogP | -0.34 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|