C12H18N2O8 — CID 11001653
(1R,5R,6S,7S,8R,12R,13S,14S)-6,7,13,14-tetrahydroxy-15,16-dioxa-3,10-diazatricyclo[10.2.1.15,8]hexadecane-2,9-dione (PubChem CID 11001653) has the molecular formula C12H18N2O8 and a molecular weight of 318.28 g/mol. Its IUPAC name is (1R,5R,6S,7S,8R,12R,13S,14S)-6,7,13,14-tetrahydroxy-15,16-dioxa-3,10-diazatricyclo[10.2.1.15,8]hexadecane-2,9-dione.
| Compound Name | (1R,5R,6S,7S,8R,12R,13S,14S)-6,7,13,14-tetrahydroxy-15,16-dioxa-3,10-diazatricyclo[10.2.1.15,8]hexadecane-2,9-dione |
|---|---|
| PubChem CID | 11001653 |
| Molecular Formula | C12H18N2O8 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (1R,5R,6S,7S,8R,12R,13S,14S)-6,7,13,14-tetrahydroxy-15,16-dioxa-3,10-diazatricyclo[10.2.1.15,8]hexadecane-2,9-dione |
| SMILES | O=C1NC[C@H]2O[C@@H](C(=O)NC[C@H]3O[C@@H]1[C@@H](O)[C@@H]3O)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C12H18N2O8/c15-5-3-1-13-11(19)9-8(18)6(16)4(22-9)2-14-12(20)10(21-3)7(5)17/h3-10,15-18H,1-2H2,(H,13,19)(H,14,20)/t3-,4-,5-,6-,7+,8+,9-,10-/m1/s1 |
| InChIKey | CCBQEEVYLDBJPX-VCGUZZPXSA-N |
| XLogP | -4.79 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |