C6H11NO3 — CID 71438218
3,4-dihydroxy-5-methylpiperidin-2-one (PubChem CID 71438218) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 3,4-dihydroxy-5-methylpiperidin-2-one.
| Compound Name | 3,4-dihydroxy-5-methylpiperidin-2-one |
|---|---|
| PubChem CID | 71438218 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 3,4-dihydroxy-5-methylpiperidin-2-one |
| SMILES | CC1CNC(=O)C(O)C1O |
| InChI | InChI=1S/C6H11NO3/c1-3-2-7-6(10)5(9)4(3)8/h3-5,8-9H,2H2,1H3,(H,7,10) |
| InChIKey | NTZKJRXXWZUJGO-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |