C7H13NO2 — CID 55299112
(3S)-3-[(1S)-1-hydroxyethyl]-4-methylpyrrolidin-2-one (PubChem CID 55299112) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (3S)-3-[(1S)-1-hydroxyethyl]-4-methylpyrrolidin-2-one.
| Compound Name | (3S)-3-[(1S)-1-hydroxyethyl]-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 55299112 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (3S)-3-[(1S)-1-hydroxyethyl]-4-methylpyrrolidin-2-one |
| SMILES | CC1CNC(=O)[C@@H]1[C@H](C)O |
| InChI | InChI=1S/C7H13NO2/c1-4-3-8-7(10)6(4)5(2)9/h4-6,9H,3H2,1-2H3,(H,8,10)/t4?,5-,6-/m0/s1 |
| InChIKey | NXXOJZVMGZUSSF-VZLNHYCJSA-N |
| XLogP | -0.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |