C5H9NO4 — CID 14867232
3,4,5-trihydroxypiperidin-2-one (PubChem CID 14867232) has the molecular formula C5H9NO4 and a molecular weight of 147.13 g/mol. Its IUPAC name is 3,4,5-trihydroxypiperidin-2-one.
| Compound Name | 3,4,5-trihydroxypiperidin-2-one |
|---|---|
| PubChem CID | 14867232 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 3,4,5-trihydroxypiperidin-2-one |
| SMILES | O=C1NCC(O)C(O)C1O |
| InChI | InChI=1S/C5H9NO4/c7-2-1-6-5(10)4(9)3(2)8/h2-4,7-9H,1H2,(H,6,10) |
| InChIKey | RRRFLTNCMKVVNJ-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |