C4H9ClN2O2 — CID 170170449
(3R,4R)-3-amino-4-hydroxypyrrolidin-2-one;hydrochloride (PubChem CID 170170449) has the molecular formula C4H9ClN2O2 and a molecular weight of 152.58 g/mol. Its IUPAC name is (3R,4R)-3-amino-4-hydroxypyrrolidin-2-one;hydrochloride.
| Compound Name | (3R,4R)-3-amino-4-hydroxypyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 170170449 |
| Molecular Formula | C4H9ClN2O2 |
| Molecular Weight | 152.58 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | (3R,4R)-3-amino-4-hydroxypyrrolidin-2-one;hydrochloride |
| SMILES | Cl.N[C@H]1C(=O)NC[C@H]1O |
| InChI | InChI=1S/C4H8N2O2.ClH/c5-3-2(7)1-6-4(3)8;/h2-3,7H,1,5H2,(H,6,8);1H/t2-,3-;/m1./s1 |
| InChIKey | QUWCFZKLRRRJDN-SWLXLVAMSA-N |
| XLogP | -1.77 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.58 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |