C10H17NO7 — CID 46936767
(3R,4R)-3-hydroxy-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxypiperidin-2-one (PubChem CID 46936767) has the molecular formula C10H17NO7 and a molecular weight of 263.25 g/mol. Its IUPAC name is (3R,4R)-3-hydroxy-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxypiperidin-2-one.
| Compound Name | (3R,4R)-3-hydroxy-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxypiperidin-2-one |
|---|---|
| PubChem CID | 46936767 |
| Molecular Formula | C10H17NO7 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (3R,4R)-3-hydroxy-4-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxypiperidin-2-one |
| SMILES | O=C1NCC[C@@H](O[C@@H]2OC[C@H](O)[C@H](O)[C@H]2O)[C@H]1O |
| InChI | InChI=1S/C10H17NO7/c12-4-3-17-10(8(15)6(4)13)18-5-1-2-11-9(16)7(5)14/h4-8,10,12-15H,1-3H2,(H,11,16)/t4-,5+,6-,7+,8+,10-/m0/s1 |
| InChIKey | BHZMHPRIYUPDCT-SANCVPIZSA-N |
| XLogP | -3.31 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |