C14H17NO4 — CID 94203015
[(3S,4S)-3-hydroxy-2-oxopiperidin-4-yl] 3-phenylpropanoate (PubChem CID 94203015) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is [(3S,4S)-3-hydroxy-2-oxopiperidin-4-yl] 3-phenylpropanoate.
| Compound Name | [(3S,4S)-3-hydroxy-2-oxopiperidin-4-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 94203015 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [(3S,4S)-3-hydroxy-2-oxopiperidin-4-yl] 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)O[C@H]1CCNC(=O)[C@H]1O |
| InChI | InChI=1S/C14H17NO4/c16-12(7-6-10-4-2-1-3-5-10)19-11-8-9-15-14(18)13(11)17/h1-5,11,13,17H,6-9H2,(H,15,18)/t11-,13-/m0/s1 |
| InChIKey | FDMZQCZOGPBMQG-AAEUAGOBSA-N |
| XLogP | 0.41 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |