C13H15ClO4S — CID 51417803
[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl] 3-phenylpropanoate (PubChem CID 51417803) has the molecular formula C13H15ClO4S and a molecular weight of 302.78 g/mol. Its IUPAC name is [(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl] 3-phenylpropanoate.
| Compound Name | [(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 51417803 |
| Molecular Formula | C13H15ClO4S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | [(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl] 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)O[C@@H]1CS(=O)(=O)C[C@@H]1Cl |
| InChI | InChI=1S/C13H15ClO4S/c14-11-8-19(16,17)9-12(11)18-13(15)7-6-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/t11-,12+/m0/s1 |
| InChIKey | XCCQIGXXZKUQPW-NWDGAFQWSA-N |
| XLogP | 1.57 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|