C21H31NO2 — CID 24843006
[2,5-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-yl] 3-phenylpropanoate (PubChem CID 24843006) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is [2,5-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-yl] 3-phenylpropanoate.
| Compound Name | [2,5-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 24843006 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | [2,5-dimethyl-1-(3-methylbut-2-enyl)piperidin-4-yl] 3-phenylpropanoate |
| SMILES | CC(C)=CCN1CC(C)C(OC(=O)CCc2ccccc2)CC1C |
| InChI | InChI=1S/C21H31NO2/c1-16(2)12-13-22-15-17(3)20(14-18(22)4)24-21(23)11-10-19-8-6-5-7-9-19/h5-9,12,17-18,20H,10-11,13-15H2,1-4H3 |
| InChIKey | TXJXNAGUOQYDNF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|