C19H28O2 — CID 57288346
tert-butyl 3-[4-(4-methylpent-3-enyl)phenyl]propanoate (PubChem CID 57288346) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is tert-butyl 3-[4-(4-methylpent-3-enyl)phenyl]propanoate.
| Compound Name | tert-butyl 3-[4-(4-methylpent-3-enyl)phenyl]propanoate |
|---|---|
| PubChem CID | 57288346 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | tert-butyl 3-[4-(4-methylpent-3-enyl)phenyl]propanoate |
| SMILES | CC(C)=CCCc1ccc(CCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H28O2/c1-15(2)7-6-8-16-9-11-17(12-10-16)13-14-18(20)21-19(3,4)5/h7,9-12H,6,8,13-14H2,1-5H3 |
| InChIKey | TYUOUDDMHBJVOA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|