C18H26O4 — CID 101184146
tert-butyl 4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoate (PubChem CID 101184146) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is tert-butyl 4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoate.
| Compound Name | tert-butyl 4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 101184146 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | tert-butyl 4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoate |
| SMILES | CC(C)(C)OC(=O)CCc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26O4/c1-17(2,3)21-15(19)12-9-13-7-10-14(11-8-13)16(20)22-18(4,5)6/h7-8,10-11H,9,12H2,1-6H3 |
| InChIKey | YWGONYWHCYPHJU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |