C6H9ClO4S — CID 6994876
[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl] acetate (PubChem CID 6994876) has the molecular formula C6H9ClO4S and a molecular weight of 212.65 g/mol. Its IUPAC name is [(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl] acetate.
| Compound Name | [(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl] acetate |
|---|---|
| PubChem CID | 6994876 |
| Molecular Formula | C6H9ClO4S |
| Molecular Weight | 212.65 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | [(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CS(=O)(=O)C[C@H]1Cl |
| InChI | InChI=1S/C6H9ClO4S/c1-4(8)11-6-3-12(9,10)2-5(6)7/h5-6H,2-3H2,1H3/t5-,6-/m1/s1 |
| InChIKey | RTTWIOWKOBUYCF-PHDIDXHHSA-N |
| XLogP | -0.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.65 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|