C6H9NO6S — CID 40531556
[(3S,4S)-4-nitro-1,1-dioxothiolan-3-yl] acetate (PubChem CID 40531556) has the molecular formula C6H9NO6S and a molecular weight of 223.21 g/mol. Its IUPAC name is [(3S,4S)-4-nitro-1,1-dioxothiolan-3-yl] acetate.
| Compound Name | [(3S,4S)-4-nitro-1,1-dioxothiolan-3-yl] acetate |
|---|---|
| PubChem CID | 40531556 |
| Molecular Formula | C6H9NO6S |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | [(3S,4S)-4-nitro-1,1-dioxothiolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CS(=O)(=O)C[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C6H9NO6S/c1-4(8)13-6-3-14(11,12)2-5(6)7(9)10/h5-6H,2-3H2,1H3/t5-,6-/m1/s1 |
| InChIKey | WMGJCCGXTDFFKU-PHDIDXHHSA-N |
| XLogP | -1.01 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|