C6H6Cl2O6S — CID 98144247
[(3S,4R)-4-carbonochloridoyloxy-1,1-dioxothiolan-3-yl] carbonochloridate (PubChem CID 98144247) has the molecular formula C6H6Cl2O6S and a molecular weight of 277.08 g/mol. Its IUPAC name is [(3S,4R)-4-carbonochloridoyloxy-1,1-dioxothiolan-3-yl] carbonochloridate.
| Compound Name | [(3S,4R)-4-carbonochloridoyloxy-1,1-dioxothiolan-3-yl] carbonochloridate |
|---|---|
| PubChem CID | 98144247 |
| Molecular Formula | C6H6Cl2O6S |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 275.93 |
| IUPAC Name | [(3S,4R)-4-carbonochloridoyloxy-1,1-dioxothiolan-3-yl] carbonochloridate |
| SMILES | O=C(Cl)O[C@H]1CS(=O)(=O)C[C@H]1OC(=O)Cl |
| InChI | InChI=1S/C6H6Cl2O6S/c7-5(9)13-3-1-15(11,12)2-4(3)14-6(8)10/h3-4H,1-2H2/t3-,4+ |
| InChIKey | KONMOGIZAMPYTO-ZXZARUISSA-N |
| XLogP | 0.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|