C17H15Cl2NO4S — CID 7116095
[(3R,4R)-4-(4-chloroanilino)-1,1-dioxothiolan-3-yl] 4-chlorobenzoate (PubChem CID 7116095) has the molecular formula C17H15Cl2NO4S and a molecular weight of 400.28 g/mol. Its IUPAC name is [(3R,4R)-4-(4-chloroanilino)-1,1-dioxothiolan-3-yl] 4-chlorobenzoate.
| Compound Name | [(3R,4R)-4-(4-chloroanilino)-1,1-dioxothiolan-3-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 7116095 |
| Molecular Formula | C17H15Cl2NO4S |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | [(3R,4R)-4-(4-chloroanilino)-1,1-dioxothiolan-3-yl] 4-chlorobenzoate |
| SMILES | O=C(O[C@H]1CS(=O)(=O)C[C@@H]1Nc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2NO4S/c18-12-3-1-11(2-4-12)17(21)24-16-10-25(22,23)9-15(16)20-14-7-5-13(19)6-8-14/h1-8,15-16,20H,9-10H2/t15-,16-/m0/s1 |
| InChIKey | DNHHVTUMAAJOKE-HOTGVXAUSA-N |
| XLogP | 3.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |