C18H18ClNO5S — CID 3554306
[4-(4-methoxyanilino)-1,1-dioxothiolan-3-yl] 4-chlorobenzoate (PubChem CID 3554306) has the molecular formula C18H18ClNO5S and a molecular weight of 395.86 g/mol. Its IUPAC name is [4-(4-methoxyanilino)-1,1-dioxothiolan-3-yl] 4-chlorobenzoate.
| Compound Name | [4-(4-methoxyanilino)-1,1-dioxothiolan-3-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 3554306 |
| Molecular Formula | C18H18ClNO5S |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [4-(4-methoxyanilino)-1,1-dioxothiolan-3-yl] 4-chlorobenzoate |
| SMILES | COc1ccc(NC2CS(=O)(=O)CC2OC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H18ClNO5S/c1-24-15-8-6-14(7-9-15)20-16-10-26(22,23)11-17(16)25-18(21)12-2-4-13(19)5-3-12/h2-9,16-17,20H,10-11H2,1H3 |
| InChIKey | LGRQAOZPZCZMGN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|