C17H16ClNO4S — CID 1401007
[(3R,4S)-4-anilino-1,1-dioxothiolan-3-yl] 4-chlorobenzoate (PubChem CID 1401007) has the molecular formula C17H16ClNO4S and a molecular weight of 365.84 g/mol. Its IUPAC name is [(3R,4S)-4-anilino-1,1-dioxothiolan-3-yl] 4-chlorobenzoate.
| Compound Name | [(3R,4S)-4-anilino-1,1-dioxothiolan-3-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 1401007 |
| Molecular Formula | C17H16ClNO4S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [(3R,4S)-4-anilino-1,1-dioxothiolan-3-yl] 4-chlorobenzoate |
| SMILES | O=C(O[C@H]1CS(=O)(=O)C[C@H]1Nc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO4S/c18-13-8-6-12(7-9-13)17(20)23-16-11-24(21,22)10-15(16)19-14-4-2-1-3-5-14/h1-9,15-16,19H,10-11H2/t15-,16+/m1/s1 |
| InChIKey | MUSGORRFQZLUHF-CVEARBPZSA-N |
| XLogP | 2.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |