C25H23NO5S — CID 21204289
[4-[benzoyl(benzyl)amino]-1,1-dioxothiolan-3-yl] benzoate (PubChem CID 21204289) has the molecular formula C25H23NO5S and a molecular weight of 449.53 g/mol. Its IUPAC name is [4-[benzoyl(benzyl)amino]-1,1-dioxothiolan-3-yl] benzoate.
| Compound Name | [4-[benzoyl(benzyl)amino]-1,1-dioxothiolan-3-yl] benzoate |
|---|---|
| PubChem CID | 21204289 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | [4-[benzoyl(benzyl)amino]-1,1-dioxothiolan-3-yl] benzoate |
| SMILES | O=C(OC1CS(=O)(=O)CC1N(Cc1ccccc1)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23NO5S/c27-24(20-12-6-2-7-13-20)26(16-19-10-4-1-5-11-19)22-17-32(29,30)18-23(22)31-25(28)21-14-8-3-9-15-21/h1-15,22-23H,16-18H2 |
| InChIKey | ZHNUKCTVBNUSJO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |