C29H25NO — CID 6580975
N-benzyl-4-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]benzamide (PubChem CID 6580975) has the molecular formula C29H25NO and a molecular weight of 403.53 g/mol. Its IUPAC name is N-benzyl-4-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]benzamide.
| Compound Name | N-benzyl-4-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]benzamide |
|---|---|
| PubChem CID | 6580975 |
| Molecular Formula | C29H25NO |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-benzyl-4-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]benzamide |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N(Cc1ccccc1)[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H25NO/c31-29(26-18-16-24(17-19-26)23-12-6-2-7-13-23)30(21-22-10-4-1-5-11-22)28-20-27(28)25-14-8-3-9-15-25/h1-19,27-28H,20-21H2/t27-,28+/m1/s1 |
| InChIKey | OYRSPUUZSADOAU-IZLXSDGUSA-N |
| XLogP | 6.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |