C22H24N2O4 — CID 122441352
benzyl-[(1S,2S)-2-[benzyl(carboxy)amino]cyclohex-3-en-1-yl]carbamic acid (PubChem CID 122441352) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is benzyl-[(1S,2S)-2-[benzyl(carboxy)amino]cyclohex-3-en-1-yl]carbamic acid.
| Compound Name | benzyl-[(1S,2S)-2-[benzyl(carboxy)amino]cyclohex-3-en-1-yl]carbamic acid |
|---|---|
| PubChem CID | 122441352 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | benzyl-[(1S,2S)-2-[benzyl(carboxy)amino]cyclohex-3-en-1-yl]carbamic acid |
| SMILES | O=C(O)N(Cc1ccccc1)[C@H]1C=CCC[C@@H]1N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H24N2O4/c25-21(26)23(15-17-9-3-1-4-10-17)19-13-7-8-14-20(19)24(22(27)28)16-18-11-5-2-6-12-18/h1-7,9-13,19-20H,8,14-16H2,(H,25,26)(H,27,28)/t19-,20-/m0/s1 |
| InChIKey | GAEQTWQPEGFTPT-PMACEKPBSA-N |
| XLogP | 4.43 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|