About benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid
benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid (PubChem CID 70664248) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid.
Molecular Properties
| Compound Name | benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid |
| PubChem CID | 70664248 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid |
| SMILES | O=C(O)N(Cc1ccccc1)[C@@H]1CCOC[C@H]1O |
| InChI | InChI=1S/C13H17NO4/c15-12-9-18-7-6-11(12)14(13(16)17)8-10-4-2-1-3-5-10/h1-5,11-12,15H,6-9H2,(H,16,17)/t11-,12-/m1/s1 |
| InChIKey | OJSYWGSZUUZDGB-VXGBXAGGSA-N |
| XLogP | 1.32 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid?
The IUPAC name of benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid (CID 70664248) is benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid.
What is the SMILES notation for benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid?
The canonical SMILES for benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid is O=C(O)N(Cc1ccccc1)[C@@H]1CCOC[C@H]1O.
What is the InChIKey of benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid?
The InChIKey is OJSYWGSZUUZDGB-VXGBXAGGSA-N. The full InChI is InChI=1S/C13H17NO4/c15-12-9-18-7-6-11(12)14(13(16)17)8-10-4-2-1-3-5-10/h1-5,11-12,15H,6-9H2,(H,16,17)/t11-,12-/m1/s1.
What are the key properties of benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid?
benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid has a molecular weight of 251.28 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[(3S,4R)-3-hydroxyoxan-4-yl]carbamic acid is sourced from PubChem (CID 70664248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).