C14H20N2O2 — CID 91447786
[(1S,2S)-2-aminocyclohexyl]-benzylcarbamic acid (PubChem CID 91447786) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is [(1S,2S)-2-aminocyclohexyl]-benzylcarbamic acid.
| Compound Name | [(1S,2S)-2-aminocyclohexyl]-benzylcarbamic acid |
|---|---|
| PubChem CID | 91447786 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | [(1S,2S)-2-aminocyclohexyl]-benzylcarbamic acid |
| SMILES | N[C@H]1CCCC[C@@H]1N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O2/c15-12-8-4-5-9-13(12)16(14(17)18)10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,15H2,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | TZMCJGAVUOZIAJ-STQMWFEESA-N |
| XLogP | 2.44 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |