C20H30N2O2 — CID 86616309
benzyl-[(1R,2R)-2-(piperidin-1-ylmethyl)cyclohexyl]carbamic acid (PubChem CID 86616309) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is benzyl-[(1R,2R)-2-(piperidin-1-ylmethyl)cyclohexyl]carbamic acid.
| Compound Name | benzyl-[(1R,2R)-2-(piperidin-1-ylmethyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 86616309 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | benzyl-[(1R,2R)-2-(piperidin-1-ylmethyl)cyclohexyl]carbamic acid |
| SMILES | O=C(O)N(Cc1ccccc1)[C@@H]1CCCC[C@@H]1CN1CCCCC1 |
| InChI | InChI=1S/C20H30N2O2/c23-20(24)22(15-17-9-3-1-4-10-17)19-12-6-5-11-18(19)16-21-13-7-2-8-14-21/h1,3-4,9-10,18-19H,2,5-8,11-16H2,(H,23,24)/t18-,19-/m1/s1 |
| InChIKey | NQDXCZSXVAWKEG-RTBURBONSA-N |
| XLogP | 4.21 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |