C22H28N2O — CID 70031264
2-amino-N-benzyl-N-[(1R,2S)-2-benzylcyclohexyl]acetamide (PubChem CID 70031264) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-amino-N-benzyl-N-[(1R,2S)-2-benzylcyclohexyl]acetamide.
| Compound Name | 2-amino-N-benzyl-N-[(1R,2S)-2-benzylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 70031264 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 2-amino-N-benzyl-N-[(1R,2S)-2-benzylcyclohexyl]acetamide |
| SMILES | NCC(=O)N(Cc1ccccc1)[C@@H]1CCCC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O/c23-16-22(25)24(17-19-11-5-2-6-12-19)21-14-8-7-13-20(21)15-18-9-3-1-4-10-18/h1-6,9-12,20-21H,7-8,13-17,23H2/t20-,21+/m0/s1 |
| InChIKey | MYXQQMWAIITPCA-LEWJYISDSA-N |
| XLogP | 3.78 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |