C14H19FN2O2 — CID 69165945
[(1S,2R)-2-aminocyclopentyl]-[2-(3-fluorophenyl)ethyl]carbamic acid (PubChem CID 69165945) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is [(1S,2R)-2-aminocyclopentyl]-[2-(3-fluorophenyl)ethyl]carbamic acid.
| Compound Name | [(1S,2R)-2-aminocyclopentyl]-[2-(3-fluorophenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 69165945 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | [(1S,2R)-2-aminocyclopentyl]-[2-(3-fluorophenyl)ethyl]carbamic acid |
| SMILES | N[C@@H]1CCC[C@@H]1N(CCc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C14H19FN2O2/c15-11-4-1-3-10(9-11)7-8-17(14(18)19)13-6-2-5-12(13)16/h1,3-4,9,12-13H,2,5-8,16H2,(H,18,19)/t12-,13+/m1/s1 |
| InChIKey | ADMGRWTWVRAVIX-OLZOCXBDSA-N |
| XLogP | 2.23 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |