C21H29FN2O3 — CID 122024382
4-[[cyclopentyl-[2-(3-fluorophenyl)ethyl]carbamoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122024382) has the molecular formula C21H29FN2O3 and a molecular weight of 376.47 g/mol. Its IUPAC name is 4-[[cyclopentyl-[2-(3-fluorophenyl)ethyl]carbamoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[cyclopentyl-[2-(3-fluorophenyl)ethyl]carbamoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122024382 |
| Molecular Formula | C21H29FN2O3 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-[[cyclopentyl-[2-(3-fluorophenyl)ethyl]carbamoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NC(=O)N(CCc2cccc(F)c2)C2CCCC2)CC1 |
| InChI | InChI=1S/C21H29FN2O3/c22-17-5-3-4-15(14-17)12-13-24(19-6-1-2-7-19)21(27)23-18-10-8-16(9-11-18)20(25)26/h3-5,14,16,18-19H,1-2,6-13H2,(H,23,27)(H,25,26) |
| InChIKey | IOXVODHJAQSKSY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |