C22H26N2O3 — CID 122025022
4-[[cyclopropyl(naphthalen-2-ylmethyl)carbamoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122025022) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[[cyclopropyl(naphthalen-2-ylmethyl)carbamoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[cyclopropyl(naphthalen-2-ylmethyl)carbamoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122025022 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-[[cyclopropyl(naphthalen-2-ylmethyl)carbamoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NC(=O)N(Cc2ccc3ccccc3c2)C2CC2)CC1 |
| InChI | InChI=1S/C22H26N2O3/c25-21(26)17-7-9-19(10-8-17)23-22(27)24(20-11-12-20)14-15-5-6-16-3-1-2-4-18(16)13-15/h1-6,13,17,19-20H,7-12,14H2,(H,23,27)(H,25,26) |
| InChIKey | ICUYODMJPLOJAA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |