C19H26N2O4 — CID 122025051
4-[[cyclopropyl-[(2-methoxyphenyl)methyl]carbamoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122025051) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[[cyclopropyl-[(2-methoxyphenyl)methyl]carbamoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[cyclopropyl-[(2-methoxyphenyl)methyl]carbamoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122025051 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-[[cyclopropyl-[(2-methoxyphenyl)methyl]carbamoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccccc1CN(C(=O)NC1CCC(C(=O)O)CC1)C1CC1 |
| InChI | InChI=1S/C19H26N2O4/c1-25-17-5-3-2-4-14(17)12-21(16-10-11-16)19(24)20-15-8-6-13(7-9-15)18(22)23/h2-5,13,15-16H,6-12H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | MLGHGWSWDVRWDT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |