C20H21FN2O3 — CID 122056065
2-[cyclopentyl-[2-(3-fluorophenyl)ethyl]carbamoyl]pyridine-4-carboxylic acid (PubChem CID 122056065) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[cyclopentyl-[2-(3-fluorophenyl)ethyl]carbamoyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[cyclopentyl-[2-(3-fluorophenyl)ethyl]carbamoyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 122056065 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[cyclopentyl-[2-(3-fluorophenyl)ethyl]carbamoyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(C(=O)N(CCc2cccc(F)c2)C2CCCC2)c1 |
| InChI | InChI=1S/C20H21FN2O3/c21-16-5-3-4-14(12-16)9-11-23(17-6-1-2-7-17)19(24)18-13-15(20(25)26)8-10-22-18/h3-5,8,10,12-13,17H,1-2,6-7,9,11H2,(H,25,26) |
| InChIKey | YENGLSXISUTBER-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |