C17H19FN4O3 — CID 146138168
2-[4-[cyclopentyl-[(3-fluorophenyl)methyl]carbamoyl]triazol-1-yl]acetic acid (PubChem CID 146138168) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is 2-[4-[cyclopentyl-[(3-fluorophenyl)methyl]carbamoyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[cyclopentyl-[(3-fluorophenyl)methyl]carbamoyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 146138168 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[4-[cyclopentyl-[(3-fluorophenyl)methyl]carbamoyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(C(=O)N(Cc2cccc(F)c2)C2CCCC2)nn1 |
| InChI | InChI=1S/C17H19FN4O3/c18-13-5-3-4-12(8-13)9-22(14-6-1-2-7-14)17(25)15-10-21(20-19-15)11-16(23)24/h3-5,8,10,14H,1-2,6-7,9,11H2,(H,23,24) |
| InChIKey | LTSYBYBWGRQTHV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |