C18H27FN2O2 — CID 67338341
[2-(tert-butylamino)cyclopentyl]-[2-(3-fluorophenyl)ethyl]carbamic acid (PubChem CID 67338341) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is [2-(tert-butylamino)cyclopentyl]-[2-(3-fluorophenyl)ethyl]carbamic acid.
| Compound Name | [2-(tert-butylamino)cyclopentyl]-[2-(3-fluorophenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 67338341 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [2-(tert-butylamino)cyclopentyl]-[2-(3-fluorophenyl)ethyl]carbamic acid |
| SMILES | CC(C)(C)NC1CCCC1N(CCc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C18H27FN2O2/c1-18(2,3)20-15-8-5-9-16(15)21(17(22)23)11-10-13-6-4-7-14(19)12-13/h4,6-7,12,15-16,20H,5,8-11H2,1-3H3,(H,22,23) |
| InChIKey | PRVQJCPGQTWBHQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |