C22H33FN2O5 — CID 67545880
[3-[cyclohexyl(2,2-dimethoxyethyl)amino]-3-oxopropyl]-[2-(3-fluorophenyl)ethyl]carbamic acid (PubChem CID 67545880) has the molecular formula C22H33FN2O5 and a molecular weight of 424.51 g/mol. Its IUPAC name is [3-[cyclohexyl(2,2-dimethoxyethyl)amino]-3-oxopropyl]-[2-(3-fluorophenyl)ethyl]carbamic acid.
| Compound Name | [3-[cyclohexyl(2,2-dimethoxyethyl)amino]-3-oxopropyl]-[2-(3-fluorophenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 67545880 |
| Molecular Formula | C22H33FN2O5 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [3-[cyclohexyl(2,2-dimethoxyethyl)amino]-3-oxopropyl]-[2-(3-fluorophenyl)ethyl]carbamic acid |
| SMILES | COC(CN(C(=O)CCN(CCc1cccc(F)c1)C(=O)O)C1CCCCC1)OC |
| InChI | InChI=1S/C22H33FN2O5/c1-29-21(30-2)16-25(19-9-4-3-5-10-19)20(26)12-14-24(22(27)28)13-11-17-7-6-8-18(23)15-17/h6-8,15,19,21H,3-5,9-14,16H2,1-2H3,(H,27,28) |
| InChIKey | UJZSXJBTGVHWQA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|