C23H35N5O4 — CID 59290471
N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(2-methyltetrazol-5-yl)phenyl]ethoxy]propanamide (PubChem CID 59290471) has the molecular formula C23H35N5O4 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(2-methyltetrazol-5-yl)phenyl]ethoxy]propanamide.
| Compound Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(2-methyltetrazol-5-yl)phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 59290471 |
| Molecular Formula | C23H35N5O4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | N-cyclohexyl-N-(2,2-dimethoxyethyl)-3-[2-[3-(2-methyltetrazol-5-yl)phenyl]ethoxy]propanamide |
| SMILES | COC(CN(C(=O)CCOCCc1cccc(-c2nnn(C)n2)c1)C1CCCCC1)OC |
| InChI | InChI=1S/C23H35N5O4/c1-27-25-23(24-26-27)19-9-7-8-18(16-19)12-14-32-15-13-21(29)28(17-22(30-2)31-3)20-10-5-4-6-11-20/h7-9,16,20,22H,4-6,10-15,17H2,1-3H3 |
| InChIKey | RKAJZEFNMHIXAD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|