C31H39N5O6 — CID 59290409
N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,2,4-oxadiazol-3-yl)phenyl]ethoxy]propanamide (PubChem CID 59290409) has the molecular formula C31H39N5O6 and a molecular weight of 577.68 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,2,4-oxadiazol-3-yl)phenyl]ethoxy]propanamide.
| Compound Name | N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,2,4-oxadiazol-3-yl)phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 59290409 |
| Molecular Formula | C31H39N5O6 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | N-cyclohexyl-N-[2-[2-(5-hydroxy-3-oxo-4H-1,4-benzoxazin-8-yl)ethylamino]ethyl]-3-[2-[3-(1,2,4-oxadiazol-3-yl)phenyl]ethoxy]propanamide |
| SMILES | O=C1COc2c(CCNCCN(C(=O)CCOCCc3cccc(-c4ncon4)c3)C3CCCCC3)ccc(O)c2N1 |
| InChI | InChI=1S/C31H39N5O6/c37-26-10-9-23(30-29(26)34-27(38)20-41-30)11-14-32-15-16-36(25-7-2-1-3-8-25)28(39)13-18-40-17-12-22-5-4-6-24(19-22)31-33-21-42-35-31/h4-6,9-10,19,21,25,32,37H,1-3,7-8,11-18,20H2,(H,34,38) |
| InChIKey | UFAJCDQLULRHRB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 139.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|