C26H42N2O4 — CID 129050055
3-[2-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]ethoxy]-N-(2,2-dimethoxyethyl)-N-propan-2-ylpropanamide (PubChem CID 129050055) has the molecular formula C26H42N2O4 and a molecular weight of 446.63 g/mol. Its IUPAC name is 3-[2-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]ethoxy]-N-(2,2-dimethoxyethyl)-N-propan-2-ylpropanamide.
| Compound Name | 3-[2-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]ethoxy]-N-(2,2-dimethoxyethyl)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 129050055 |
| Molecular Formula | C26H42N2O4 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | 3-[2-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]ethoxy]-N-(2,2-dimethoxyethyl)-N-propan-2-ylpropanamide |
| SMILES | COC(CN(C(=O)CCOCCc1cccc(CN2CC3CCCC3C2)c1)C(C)C)OC |
| InChI | InChI=1S/C26H42N2O4/c1-20(2)28(19-26(30-3)31-4)25(29)12-14-32-13-11-21-7-5-8-22(15-21)16-27-17-23-9-6-10-24(23)18-27/h5,7-8,15,20,23-24,26H,6,9-14,16-19H2,1-4H3 |
| InChIKey | AOBJRNWFBKXTIB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|