C36H44N2O5 — CID 175161805
tert-butyl 3-[2-[3-[[(3aS,6aR)-5-[(2-phenylphenoxy)carbonylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]phenyl]ethoxy]propanoate (PubChem CID 175161805) has the molecular formula C36H44N2O5 and a molecular weight of 584.76 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-[[(3aS,6aR)-5-[(2-phenylphenoxy)carbonylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]phenyl]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[3-[[(3aS,6aR)-5-[(2-phenylphenoxy)carbonylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]phenyl]ethoxy]propanoate |
|---|---|
| PubChem CID | 175161805 |
| Molecular Formula | C36H44N2O5 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | tert-butyl 3-[2-[3-[[(3aS,6aR)-5-[(2-phenylphenoxy)carbonylamino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]phenyl]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCc1cccc(CN2C[C@H]3CC(NC(=O)Oc4ccccc4-c4ccccc4)C[C@H]3C2)c1 |
| InChI | InChI=1S/C36H44N2O5/c1-36(2,3)43-34(39)17-19-41-18-16-26-10-9-11-27(20-26)23-38-24-29-21-31(22-30(29)25-38)37-35(40)42-33-15-8-7-14-32(33)28-12-5-4-6-13-28/h4-15,20,29-31H,16-19,21-25H2,1-3H3,(H,37,40)/t29-,30+,31? |
| InChIKey | KPARKQJLPOOKQI-BETPUDKTSA-N |
| XLogP | 6.64 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|