C34H40N2O4 — CID 129049956
tert-butyl 3-[3-[[(3aS,6aR)-5-[(2-phenylphenyl)carbamoyloxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]phenyl]propanoate (PubChem CID 129049956) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is tert-butyl 3-[3-[[(3aS,6aR)-5-[(2-phenylphenyl)carbamoyloxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]phenyl]propanoate.
| Compound Name | tert-butyl 3-[3-[[(3aS,6aR)-5-[(2-phenylphenyl)carbamoyloxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 129049956 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | tert-butyl 3-[3-[[(3aS,6aR)-5-[(2-phenylphenyl)carbamoyloxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methyl]phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1cccc(CN2C[C@H]3CC(OC(=O)Nc4ccccc4-c4ccccc4)C[C@H]3C2)c1 |
| InChI | InChI=1S/C34H40N2O4/c1-34(2,3)40-32(37)17-16-24-10-9-11-25(18-24)21-36-22-27-19-29(20-28(27)23-36)39-33(38)35-31-15-8-7-14-30(31)26-12-5-4-6-13-26/h4-15,18,27-29H,16-17,19-23H2,1-3H3,(H,35,38)/t27-,28+,29? |
| InChIKey | XDTGUSATXJJGHT-ULJKERAFSA-N |
| XLogP | 7.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |