C30H33N3O4 — CID 145281920
[2-[3-[4-(hydroxymethyl)anilino]-3-oxopropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate (PubChem CID 145281920) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is [2-[3-[4-(hydroxymethyl)anilino]-3-oxopropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [2-[3-[4-(hydroxymethyl)anilino]-3-oxopropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 145281920 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | [2-[3-[4-(hydroxymethyl)anilino]-3-oxopropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=C(CCN1CC2CC(OC(=O)Nc3ccccc3-c3ccccc3)CC2C1)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C30H33N3O4/c34-20-21-10-12-25(13-11-21)31-29(35)14-15-33-18-23-16-26(17-24(23)19-33)37-30(36)32-28-9-5-4-8-27(28)22-6-2-1-3-7-22/h1-13,23-24,26,34H,14-20H2,(H,31,35)(H,32,36) |
| InChIKey | KTQFYKBMVWRULP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |