C37H49N3O6 — CID 145294084
[2-[[4-[2-[3-[2,2-dimethoxyethyl(methyl)amino]-3-oxopropoxy]ethyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate;molecular hydrogen (PubChem CID 145294084) has the molecular formula C37H49N3O6 and a molecular weight of 631.81 g/mol. Its IUPAC name is [2-[[4-[2-[3-[2,2-dimethoxyethyl(methyl)amino]-3-oxopropoxy]ethyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate;molecular hydrogen.
| Compound Name | [2-[[4-[2-[3-[2,2-dimethoxyethyl(methyl)amino]-3-oxopropoxy]ethyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 145294084 |
| Molecular Formula | C37H49N3O6 |
| Molecular Weight | 631.81 g/mol |
| Exact Mass | 631.36 |
| IUPAC Name | [2-[[4-[2-[3-[2,2-dimethoxyethyl(methyl)amino]-3-oxopropoxy]ethyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate;molecular hydrogen |
| SMILES | COC(CN(C)C(=O)CCOCCc1ccc(CN2CC3CC(OC(=O)Nc4ccccc4-c4ccccc4)CC3C2)cc1)OC.[H][H] |
| InChI | InChI=1S/C37H47N3O6.H2/c1-39(26-36(43-2)44-3)35(41)18-20-45-19-17-27-13-15-28(16-14-27)23-40-24-30-21-32(22-31(30)25-40)46-37(42)38-34-12-8-7-11-33(34)29-9-5-4-6-10-29;/h4-16,30-32,36H,17-26H2,1-3H3,(H,38,42);1H |
| InChIKey | BZGAMPBSWOBHQD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.81 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|