C39H49N3O6 — CID 129050254
[(3aR,6aS)-2-[[4-[2-[3-[cyclopropyl(2,2-dimethoxyethyl)amino]-3-oxopropoxy]ethyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate (PubChem CID 129050254) has the molecular formula C39H49N3O6 and a molecular weight of 655.84 g/mol. Its IUPAC name is [(3aR,6aS)-2-[[4-[2-[3-[cyclopropyl(2,2-dimethoxyethyl)amino]-3-oxopropoxy]ethyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [(3aR,6aS)-2-[[4-[2-[3-[cyclopropyl(2,2-dimethoxyethyl)amino]-3-oxopropoxy]ethyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 129050254 |
| Molecular Formula | C39H49N3O6 |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.36 |
| IUPAC Name | [(3aR,6aS)-2-[[4-[2-[3-[cyclopropyl(2,2-dimethoxyethyl)amino]-3-oxopropoxy]ethyl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] N-(2-phenylphenyl)carbamate |
| SMILES | COC(CN(C(=O)CCOCCc1ccc(CN2C[C@H]3CC(OC(=O)Nc4ccccc4-c4ccccc4)C[C@H]3C2)cc1)C1CC1)OC |
| InChI | InChI=1S/C39H49N3O6/c1-45-38(46-2)27-42(33-16-17-33)37(43)19-21-47-20-18-28-12-14-29(15-13-28)24-41-25-31-22-34(23-32(31)26-41)48-39(44)40-36-11-7-6-10-35(36)30-8-4-3-5-9-30/h3-15,31-34,38H,16-27H2,1-2H3,(H,40,44)/t31-,32+,34? |
| InChIKey | SGSFXSXLMSJKPS-AGUBCAFJSA-N |
| XLogP | 6.37 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|