C38H50N2O5 — CID 145294079
tert-butyl 3-[2-[3-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)ethyl]phenyl]ethoxy]propanoate;methyl N-(2-phenylphenyl)carbamate (PubChem CID 145294079) has the molecular formula C38H50N2O5 and a molecular weight of 614.83 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)ethyl]phenyl]ethoxy]propanoate;methyl N-(2-phenylphenyl)carbamate.
| Compound Name | tert-butyl 3-[2-[3-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)ethyl]phenyl]ethoxy]propanoate;methyl N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 145294079 |
| Molecular Formula | C38H50N2O5 |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.37 |
| IUPAC Name | tert-butyl 3-[2-[3-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)ethyl]phenyl]ethoxy]propanoate;methyl N-(2-phenylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)CCOCCc1cccc(CCN2CC3CCCC3C2)c1.COC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H37NO3.C14H13NO2/c1-24(2,3)28-23(26)12-15-27-14-11-20-7-4-6-19(16-20)10-13-25-17-21-8-5-9-22(21)18-25;1-17-14(16)15-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h4,6-7,16,21-22H,5,8-15,17-18H2,1-3H3;2-10H,1H3,(H,15,16) |
| InChIKey | KTZMYUAAXHNODO-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|